C22H16FN3O4S — CID 78319528
2-(4-fluorophenoxy)-N-(3-sulfamoylphenyl)quinoline-3-carboxamide (PubChem CID 78319528) has the molecular formula C22H16FN3O4S and a molecular weight of 437.45 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(3-sulfamoylphenyl)quinoline-3-carboxamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(3-sulfamoylphenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 78319528 |
| Molecular Formula | C22H16FN3O4S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(3-sulfamoylphenyl)quinoline-3-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2cc3ccccc3nc2Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H16FN3O4S/c23-15-8-10-17(11-9-15)30-22-19(12-14-4-1-2-7-20(14)26-22)21(27)25-16-5-3-6-18(13-16)31(24,28)29/h1-13H,(H,25,27)(H2,24,28,29) |
| InChIKey | MRYZLZGEYZDMQS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |