C20H17F3N2 — CID 78320888
1-methyl-3-[2,2,2-trifluoro-1-(1-methylindol-3-yl)ethyl]indole (PubChem CID 78320888) has the molecular formula C20H17F3N2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-methyl-3-[2,2,2-trifluoro-1-(1-methylindol-3-yl)ethyl]indole.
| Compound Name | 1-methyl-3-[2,2,2-trifluoro-1-(1-methylindol-3-yl)ethyl]indole |
|---|---|
| PubChem CID | 78320888 |
| Molecular Formula | C20H17F3N2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-methyl-3-[2,2,2-trifluoro-1-(1-methylindol-3-yl)ethyl]indole |
| SMILES | Cn1cc(C(c2cn(C)c3ccccc23)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C20H17F3N2/c1-24-11-15(13-7-3-5-9-17(13)24)19(20(21,22)23)16-12-25(2)18-10-6-4-8-14(16)18/h3-12,19H,1-2H3 |
| InChIKey | RIDVLFVMQKNROW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |