C16H29N5O3S — CID 78321188
(2S)-6-[5-[(3aS,4S,6aR)-2-amino-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-2-aminohexanoic acid (PubChem CID 78321188) has the molecular formula C16H29N5O3S and a molecular weight of 371.51 g/mol. Its IUPAC name is (2S)-6-[5-[(3aS,4S,6aR)-2-amino-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-2-aminohexanoic acid.
| Compound Name | (2S)-6-[5-[(3aS,4S,6aR)-2-amino-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-2-aminohexanoic acid |
|---|---|
| PubChem CID | 78321188 |
| Molecular Formula | C16H29N5O3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (2S)-6-[5-[(3aS,4S,6aR)-2-amino-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-2-aminohexanoic acid |
| SMILES | NC1=N[C@H]2[C@H](CS[C@H]2CCCCC(=O)NCCCC[C@H](N)C(=O)O)N1 |
| InChI | InChI=1S/C16H29N5O3S/c17-10(15(23)24)5-3-4-8-19-13(22)7-2-1-6-12-14-11(9-25-12)20-16(18)21-14/h10-12,14H,1-9,17H2,(H,19,22)(H,23,24)(H3,18,20,21)/t10-,11-,12-,14-/m0/s1 |
| InChIKey | XLEWGYNJXGQGHL-MNXVOIDGSA-N |
| XLogP | 0.02 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|