C15H19N3OS — CID 7832165
(1S,9S)-11-(3-isothiocyanatopropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 7832165) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is (1S,9S)-11-(3-isothiocyanatopropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-(3-isothiocyanatopropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 7832165 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (1S,9S)-11-(3-isothiocyanatopropyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1C[C@H]1C[C@H]2CN(CCCN=C=S)C1 |
| InChI | InChI=1S/C15H19N3OS/c19-15-4-1-3-14-13-7-12(9-18(14)15)8-17(10-13)6-2-5-16-11-20/h1,3-4,12-13H,2,5-10H2/t12-,13-/m0/s1 |
| InChIKey | UQILZNTYUBFCSS-STQMWFEESA-N |
| XLogP | 1.76 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|