C24H18N4O3S — CID 78322438
N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]methanesulfonamide (PubChem CID 78322438) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 78322438 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[3-[2-[(E)-2-(4-cyanophenyl)ethenyl]-4-oxoquinazolin-3-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-n2c(/C=C/c3ccc(C#N)cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C24H18N4O3S/c1-32(30,31)27-19-5-4-6-20(15-19)28-23(14-13-17-9-11-18(16-25)12-10-17)26-22-8-3-2-7-21(22)24(28)29/h2-15,27H,1H3/b14-13+ |
| InChIKey | OJXPVVMEZOBFSG-BUHFOSPRSA-N |
| XLogP | 3.80 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |