C15H16N2O9 — CID 78323016
(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate (PubChem CID 78323016) has the molecular formula C15H16N2O9 and a molecular weight of 368.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate |
|---|---|
| PubChem CID | 78323016 |
| Molecular Formula | C15H16N2O9 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2,5-dioxopyrrol-1-yl)pentanoate |
| SMILES | O=C(CCCCN1C(=O)C=CC1=O)OCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H16N2O9/c18-10-4-5-11(19)16(10)8-2-1-3-14(22)24-9-25-15(23)26-17-12(20)6-7-13(17)21/h4-5H,1-3,6-9H2 |
| InChIKey | QVHXWFSPODFCHS-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|