C15H13Cl2N — CID 78323119
4-[(E)-2-(2,6-dichlorophenyl)ethenyl]-N-methylaniline (PubChem CID 78323119) has the molecular formula C15H13Cl2N and a molecular weight of 278.18 g/mol. Its IUPAC name is 4-[(E)-2-(2,6-dichlorophenyl)ethenyl]-N-methylaniline.
| Compound Name | 4-[(E)-2-(2,6-dichlorophenyl)ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 78323119 |
| Molecular Formula | C15H13Cl2N |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-[(E)-2-(2,6-dichlorophenyl)ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2N/c1-18-12-8-5-11(6-9-12)7-10-13-14(16)3-2-4-15(13)17/h2-10,18H,1H3/b10-7+ |
| InChIKey | MYAVIEFPFCTLFJ-JXMROGBWSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|