C27H38F2NO3P — CID 78323294
3-[[2,5-difluoro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 78323294) has the molecular formula C27H38F2NO3P and a molecular weight of 493.58 g/mol. Its IUPAC name is 3-[[2,5-difluoro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2,5-difluoro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78323294 |
| Molecular Formula | C27H38F2NO3P |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 3-[[2,5-difluoro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(CCCCCC2(c3ccccc3)CCCCC2)cc1F |
| InChI | InChI=1S/C27H38F2NO3P/c28-25-20-23(21-30-17-10-18-34(31,32)33)26(29)19-22(25)11-4-2-7-14-27(15-8-3-9-16-27)24-12-5-1-6-13-24/h1,5-6,12-13,19-20,30H,2-4,7-11,14-18,21H2,(H2,31,32,33) |
| InChIKey | NRFPLSCOBJDFPL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|