C21H30ClN3O2 — CID 78323370
1-butyl-7-chloro-N-[3-(diethylamino)propyl]-4-oxoquinoline-3-carboxamide (PubChem CID 78323370) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is 1-butyl-7-chloro-N-[3-(diethylamino)propyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-butyl-7-chloro-N-[3-(diethylamino)propyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 78323370 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-butyl-7-chloro-N-[3-(diethylamino)propyl]-4-oxoquinoline-3-carboxamide |
| SMILES | CCCCn1cc(C(=O)NCCCN(CC)CC)c(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H30ClN3O2/c1-4-7-13-25-15-18(20(26)17-10-9-16(22)14-19(17)25)21(27)23-11-8-12-24(5-2)6-3/h9-10,14-15H,4-8,11-13H2,1-3H3,(H,23,27) |
| InChIKey | AXFQQGBFYMGHHQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|