C18H16O3S — CID 78324154
1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-4-phenylbutane-1,4-dione (PubChem CID 78324154) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-4-phenylbutane-1,4-dione.
| Compound Name | 1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 78324154 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzoxathiin-6-yl)-4-phenylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)SCCO2)c1ccccc1 |
| InChI | InChI=1S/C18H16O3S/c19-15(13-4-2-1-3-5-13)7-8-16(20)14-6-9-17-18(12-14)22-11-10-21-17/h1-6,9,12H,7-8,10-11H2 |
| InChIKey | MFRNZNRRGPCYRK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |