C13H13N2O4+ — CID 7832433
(E,2S)-4-cyano-5-ethoxy-5-oxo-2-pyridin-1-ium-1-ylpent-3-enoic acid (PubChem CID 7832433) has the molecular formula C13H13N2O4+ and a molecular weight of 261.26 g/mol. Its IUPAC name is (E,2S)-4-cyano-5-ethoxy-5-oxo-2-pyridin-1-ium-1-ylpent-3-enoic acid.
| Compound Name | (E,2S)-4-cyano-5-ethoxy-5-oxo-2-pyridin-1-ium-1-ylpent-3-enoic acid |
|---|---|
| PubChem CID | 7832433 |
| Molecular Formula | C13H13N2O4+ |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (E,2S)-4-cyano-5-ethoxy-5-oxo-2-pyridin-1-ium-1-ylpent-3-enoic acid |
| SMILES | CCOC(=O)/C(C#N)=C/[C@@H](C(=O)O)[n+]1ccccc1 |
| InChI | InChI=1S/C13H12N2O4/c1-2-19-13(18)10(9-14)8-11(12(16)17)15-6-4-3-5-7-15/h3-8,11H,2H2,1H3/p+1/b10-8+/t11-/m0/s1 |
| InChIKey | DZEPRGCNNWFXJD-UQSGXBNBSA-O |
| XLogP | 0.61 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|