C9H11NO5S — CID 89441085
ethyl (2E)-2-cyano-4-methoxysulfonylpenta-2,4-dienoate (PubChem CID 89441085) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-4-methoxysulfonylpenta-2,4-dienoate.
| Compound Name | ethyl (2E)-2-cyano-4-methoxysulfonylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 89441085 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | ethyl (2E)-2-cyano-4-methoxysulfonylpenta-2,4-dienoate |
| SMILES | C=C(/C=C(\C#N)C(=O)OCC)S(=O)(=O)OC |
| InChI | InChI=1S/C9H11NO5S/c1-4-15-9(11)8(6-10)5-7(2)16(12,13)14-3/h5H,2,4H2,1,3H3/b8-5+ |
| InChIKey | BUHDJEUNXLMEOI-VMPITWQZSA-N |
| XLogP | 0.49 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|