C15H21N3O4 — CID 14687156
diethyl (E,4E)-4-[amino(pyrrolidin-1-yl)methylidene]-2-cyanopent-2-enedioate (PubChem CID 14687156) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is diethyl (E,4E)-4-[amino(pyrrolidin-1-yl)methylidene]-2-cyanopent-2-enedioate.
| Compound Name | diethyl (E,4E)-4-[amino(pyrrolidin-1-yl)methylidene]-2-cyanopent-2-enedioate |
|---|---|
| PubChem CID | 14687156 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | diethyl (E,4E)-4-[amino(pyrrolidin-1-yl)methylidene]-2-cyanopent-2-enedioate |
| SMILES | CCOC(=O)/C(C#N)=C/C(C(=O)OCC)=C(/N)N1CCCC1 |
| InChI | InChI=1S/C15H21N3O4/c1-3-21-14(19)11(10-16)9-12(15(20)22-4-2)13(17)18-7-5-6-8-18/h9H,3-8,17H2,1-2H3/b11-9+,13-12+ |
| InChIKey | NDOWTDZMHQDROQ-GNDASISDSA-N |
| XLogP | 0.83 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|