C15H21N3O4 — CID 135703679
ethyl (E,2Z)-4-cyano-2-[ethoxy(hydroxy)methylidene]-5-imino-5-pyrrolidin-1-ylpent-3-enoate (PubChem CID 135703679) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl (E,2Z)-4-cyano-2-[ethoxy(hydroxy)methylidene]-5-imino-5-pyrrolidin-1-ylpent-3-enoate.
| Compound Name | ethyl (E,2Z)-4-cyano-2-[ethoxy(hydroxy)methylidene]-5-imino-5-pyrrolidin-1-ylpent-3-enoate |
|---|---|
| PubChem CID | 135703679 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | ethyl (E,2Z)-4-cyano-2-[ethoxy(hydroxy)methylidene]-5-imino-5-pyrrolidin-1-ylpent-3-enoate |
| SMILES | [H]/N=C(C(\C#N)=C\C(C(=O)OCC)=C(/O)OCC)/N1CCCC1 |
| InChI | InChI=1S/C15H21N3O4/c1-3-21-14(19)12(15(20)22-4-2)9-11(10-16)13(17)18-7-5-6-8-18/h9,17,19H,3-8H2,1-2H3/b11-9+,14-12-,17-13+ |
| InChIKey | JAXIDJCCWQIGNX-MJIAXKFJSA-N |
| XLogP | 1.88 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|