C17H23N5O3 — CID 135678642
ethyl 5-[(E)-2-cyano-3-imino-3-(4-methylpiperazin-1-yl)prop-1-enyl]-4-hydroxy-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 135678642) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is ethyl 5-[(E)-2-cyano-3-imino-3-(4-methylpiperazin-1-yl)prop-1-enyl]-4-hydroxy-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(E)-2-cyano-3-imino-3-(4-methylpiperazin-1-yl)prop-1-enyl]-4-hydroxy-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135678642 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | ethyl 5-[(E)-2-cyano-3-imino-3-(4-methylpiperazin-1-yl)prop-1-enyl]-4-hydroxy-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | [H]/N=C(C(\C#N)=C\c1[nH]c(C)c(C(=O)OCC)c1O)/N1CCN(C)CC1 |
| InChI | InChI=1S/C17H23N5O3/c1-4-25-17(24)14-11(2)20-13(15(14)23)9-12(10-18)16(19)22-7-5-21(3)6-8-22/h9,19-20,23H,4-8H2,1-3H3/b12-9+,19-16+ |
| InChIKey | OOJRUIUEACOBPU-LNGMRNOVSA-N |
| XLogP | 1.34 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|