C20H21N3O4 — CID 9365671
ethyl 5-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 9365671) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is ethyl 5-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9365671 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl 5-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C=C(\C#N)C(=O)Nc2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C20H21N3O4/c1-5-27-20(25)18-12(2)17(22-13(18)3)10-14(11-21)19(24)23-15-6-8-16(26-4)9-7-15/h6-10,22H,5H2,1-4H3,(H,23,24)/b14-10+ |
| InChIKey | NZCDCSCGBKXNKX-GXDHUFHOSA-N |
| XLogP | 3.36 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|