C14H17F3N4O3 — CID 135465561
ethyl 4-[(2Z,4E)-2-cyano-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienimidoyl]piperazine-1-carboxylate (PubChem CID 135465561) has the molecular formula C14H17F3N4O3 and a molecular weight of 346.31 g/mol. Its IUPAC name is ethyl 4-[(2Z,4E)-2-cyano-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2Z,4E)-2-cyano-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 135465561 |
| Molecular Formula | C14H17F3N4O3 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | ethyl 4-[(2Z,4E)-2-cyano-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienimidoyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(C(/C#N)=C\C=C(\O)C(F)(F)F)\N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C14H17F3N4O3/c1-2-24-13(23)21-7-5-20(6-8-21)12(19)10(9-18)3-4-11(22)14(15,16)17/h3-4,19,22H,2,5-8H2,1H3/b10-3-,11-4+,19-12- |
| InChIKey | SIALBFSYNGNYPU-UEHOZZPCSA-N |
| XLogP | 2.19 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|