C10H11NO4 — CID 68938411
cis-(1R,2S)-2-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid (PubChem CID 68938411) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 68938411 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | cis-(1R,2S)-2-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid |
| SMILES | CCOC(=O)C(C#N)=C[C@@H]1C[C@H]1C(=O)O |
| InChI | InChI=1S/C10H11NO4/c1-2-15-10(14)7(5-11)3-6-4-8(6)9(12)13/h3,6,8H,2,4H2,1H3,(H,12,13)/t6-,8-/m1/s1 |
| InChIKey | TVBADAKWJUSEIH-HTRCEHHLSA-N |
| XLogP | 0.72 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|