C13H19NO3 — CID 7061468
ethyl 2-cyano-3-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enoate (PubChem CID 7061468) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethyl 2-cyano-3-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7061468 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | ethyl 2-cyano-3-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C13H19NO3/c1-4-16-12(15)11(9-14)7-10-5-6-17-13(2,3)8-10/h7,10H,4-6,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | YDFKHOVFNWIXOF-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|