C13H18N2O3 — CID 755431
ethyl (E)-3-(4-amino-6,6-dimethyl-2,5-dihydropyran-3-yl)-2-cyanoprop-2-enoate (PubChem CID 755431) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is ethyl (E)-3-(4-amino-6,6-dimethyl-2,5-dihydropyran-3-yl)-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-(4-amino-6,6-dimethyl-2,5-dihydropyran-3-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 755431 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | ethyl (E)-3-(4-amino-6,6-dimethyl-2,5-dihydropyran-3-yl)-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/C1=C(N)CC(C)(C)OC1 |
| InChI | InChI=1S/C13H18N2O3/c1-4-17-12(16)9(7-14)5-10-8-18-13(2,3)6-11(10)15/h5H,4,6,8,15H2,1-3H3/b9-5+ |
| InChIKey | LDMXBGXVSVPYIJ-WEVVVXLNSA-N |
| XLogP | 1.41 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|