C9H13NO2 — CID 142887757
2,2-dimethyloxane-4-carbonyl cyanide (PubChem CID 142887757) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2,2-dimethyloxane-4-carbonyl cyanide.
| Compound Name | 2,2-dimethyloxane-4-carbonyl cyanide |
|---|---|
| PubChem CID | 142887757 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2,2-dimethyloxane-4-carbonyl cyanide |
| SMILES | CC1(C)CC(C(=O)C#N)CCO1 |
| InChI | InChI=1S/C9H13NO2/c1-9(2)5-7(3-4-12-9)8(11)6-10/h7H,3-5H2,1-2H3 |
| InChIKey | MVNWZOZBIJRJBJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|