C11H17N3O3 — CID 83028549
N-(cyanomethyl)-N'-(2,2-dimethyloxan-4-yl)oxamide (PubChem CID 83028549) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(2,2-dimethyloxan-4-yl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(2,2-dimethyloxan-4-yl)oxamide |
|---|---|
| PubChem CID | 83028549 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-(cyanomethyl)-N'-(2,2-dimethyloxan-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)NCC#N)CCO1 |
| InChI | InChI=1S/C11H17N3O3/c1-11(2)7-8(3-6-17-11)14-10(16)9(15)13-5-4-12/h8H,3,5-7H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | JHVAIAOKRFMYQV-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|