C7H16ClNO — CID 86675380
(2,2-dimethyloxan-4-yl)azanium chloride (PubChem CID 86675380) has the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. Its IUPAC name is (2,2-dimethyloxan-4-yl)azanium chloride.
| Compound Name | (2,2-dimethyloxan-4-yl)azanium chloride |
|---|---|
| PubChem CID | 86675380 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (2,2-dimethyloxan-4-yl)azanium chloride |
| SMILES | CC1(C)CC([NH3+])CCO1.[Cl-] |
| InChI | InChI=1S/C7H15NO.ClH/c1-7(2)5-6(8)3-4-9-7;/h6H,3-5,8H2,1-2H3;1H |
| InChIKey | HDJOGFORYNQVNR-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |