C7H16ClNO — CID 67124190
2,2-dimethyloxan-4-amine;hydrochloride (PubChem CID 67124190) has the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. Its IUPAC name is 2,2-dimethyloxan-4-amine;hydrochloride.
| Compound Name | 2,2-dimethyloxan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 67124190 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2,2-dimethyloxan-4-amine;hydrochloride |
| SMILES | CC1(C)CC(N)CCO1.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-7(2)5-6(8)3-4-9-7;/h6H,3-5,8H2,1-2H3;1H |
| InChIKey | HDJOGFORYNQVNR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |