C8H18ClNO — CID 141410410
N,2,2-trimethyloxan-4-amine;hydrochloride (PubChem CID 141410410) has the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. Its IUPAC name is N,2,2-trimethyloxan-4-amine;hydrochloride.
| Compound Name | N,2,2-trimethyloxan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 141410410 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N,2,2-trimethyloxan-4-amine;hydrochloride |
| SMILES | CNC1CCOC(C)(C)C1.Cl |
| InChI | InChI=1S/C8H17NO.ClH/c1-8(2)6-7(9-3)4-5-10-8;/h7,9H,4-6H2,1-3H3;1H |
| InChIKey | IXSHVVGWQUVUJQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |