C27H29ClN2O3 — CID 78335184
1-(4-tert-butylphenyl)-7-chloro-2-(6-methyl-2-pyridinyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78335184) has the molecular formula C27H29ClN2O3 and a molecular weight of 464.99 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-7-chloro-2-(6-methyl-2-pyridinyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-tert-butylphenyl)-7-chloro-2-(6-methyl-2-pyridinyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78335184 |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-(4-tert-butylphenyl)-7-chloro-2-(6-methyl-2-pyridinyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1cccc(N2C(=O)C3=C(C(=O)C4CC(Cl)CCC4O3)C2c2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C27H29ClN2O3/c1-15-6-5-7-21(29-15)30-23(16-8-10-17(11-9-16)27(2,3)4)22-24(31)19-14-18(28)12-13-20(19)33-25(22)26(30)32/h5-11,18-20,23H,12-14H2,1-4H3 |
| InChIKey | GUPSGHDLEPYZSL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|