C16H28N2 — CID 783466
1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-ethylpiperazine (PubChem CID 783466) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-ethylpiperazine.
| Compound Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 783466 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(CC2=CC[C@H]3C[C@@H]2C3(C)C)CC1 |
| InChI | InChI=1S/C16H28N2/c1-4-17-7-9-18(10-8-17)12-13-5-6-14-11-15(13)16(14,2)3/h5,14-15H,4,6-12H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | BJJBVQAWVRUBKV-GJZGRUSLSA-N |
| XLogP | 2.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|