C17H30N2 — CID 2846119
N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 2846119) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 2846119 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | CN1CCC(N(C)CC2=CCC3CC2C3(C)C)CC1 |
| InChI | InChI=1S/C17H30N2/c1-17(2)14-6-5-13(16(17)11-14)12-19(4)15-7-9-18(3)10-8-15/h5,14-16H,6-12H2,1-4H3 |
| InChIKey | RAHXEMCAPWJHLY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|