C15H11F2NO4 — CID 78358043
methyl 3-[(2,6-difluorophenyl)carbamoyl]-4-hydroxybenzoate (PubChem CID 78358043) has the molecular formula C15H11F2NO4 and a molecular weight of 307.25 g/mol. Its IUPAC name is methyl 3-[(2,6-difluorophenyl)carbamoyl]-4-hydroxybenzoate.
| Compound Name | methyl 3-[(2,6-difluorophenyl)carbamoyl]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 78358043 |
| Molecular Formula | C15H11F2NO4 |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | methyl 3-[(2,6-difluorophenyl)carbamoyl]-4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)c(C(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C15H11F2NO4/c1-22-15(21)8-5-6-12(19)9(7-8)14(20)18-13-10(16)3-2-4-11(13)17/h2-7,19H,1H3,(H,18,20) |
| InChIKey | QJQCLBBKRPEVLI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |