C15H11Cl2NO — CID 783595
(2,5-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 783595) has the molecular formula C15H11Cl2NO and a molecular weight of 292.17 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2,5-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 783595 |
| Molecular Formula | C15H11Cl2NO |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (2,5-dichlorophenyl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H11Cl2NO/c16-11-5-6-13(17)12(9-11)15(19)18-8-7-10-3-1-2-4-14(10)18/h1-6,9H,7-8H2 |
| InChIKey | PNCFNINZVBGBST-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |