C13H19N3O6S — CID 7837489
N-[(3R)-1,1-dioxothiolan-3-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7837489) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7837489 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CN1C(=O)C(=O)N(CC(=O)N[C@@H]2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C13H19N3O6S/c1-8(2)5-15-11(18)12(19)16(13(15)20)6-10(17)14-9-3-4-23(21,22)7-9/h8-9H,3-7H2,1-2H3,(H,14,17)/t9-/m1/s1 |
| InChIKey | IHQIYPMZQATBIA-SECBINFHSA-N |
| XLogP | -1.26 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|