C16H23IN4O3S — CID 78376937
N-[4-(azepan-1-ylsulfonyl)phenyl]-4-iodopyrazolidine-3-carboxamide (PubChem CID 78376937) has the molecular formula C16H23IN4O3S and a molecular weight of 478.36 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-4-iodopyrazolidine-3-carboxamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-iodopyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 78376937 |
| Molecular Formula | C16H23IN4O3S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-iodopyrazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)C1NNCC1I |
| InChI | InChI=1S/C16H23IN4O3S/c17-14-11-18-20-15(14)16(22)19-12-5-7-13(8-6-12)25(23,24)21-9-3-1-2-4-10-21/h5-8,14-15,18,20H,1-4,9-11H2,(H,19,22) |
| InChIKey | OYKDIUAQZJUJGJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|