C18H22O2 — CID 78384618
18-hydroxyoctadeca-7,9,16-trien-11,13-diyn-4-one (PubChem CID 78384618) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 18-hydroxyoctadeca-7,9,16-trien-11,13-diyn-4-one.
| Compound Name | 18-hydroxyoctadeca-7,9,16-trien-11,13-diyn-4-one |
|---|---|
| PubChem CID | 78384618 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 18-hydroxyoctadeca-7,9,16-trien-11,13-diyn-4-one |
| SMILES | CCCC(=O)CCC=CC=CC#CC#CCC=CCO |
| InChI | InChI=1S/C18H22O2/c1-2-15-18(20)16-13-11-9-7-5-3-4-6-8-10-12-14-17-19/h5,7,9,11-12,14,19H,2,10,13,15-17H2,1H3 |
| InChIKey | ZFOBEJMRESDBPQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|