C29H34O9 — CID 78385050
methyl 2-[14-acetyloxy-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),9-dien-16-yl]acetate (PubChem CID 78385050) has the molecular formula C29H34O9 and a molecular weight of 526.58 g/mol. Its IUPAC name is methyl 2-[14-acetyloxy-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),9-dien-16-yl]acetate.
| Compound Name | methyl 2-[14-acetyloxy-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),9-dien-16-yl]acetate |
|---|---|
| PubChem CID | 78385050 |
| Molecular Formula | C29H34O9 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | methyl 2-[14-acetyloxy-6-(furan-3-yl)-13-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),9-dien-16-yl]acetate |
| SMILES | COC(=O)CC1C2(C)C(=O)C(O)(CC3=C2CCC2(C)C3=CC(=O)OC2c2ccoc2)C(OC(C)=O)C1(C)C |
| InChI | InChI=1S/C29H34O9/c1-15(30)37-25-26(2,3)20(12-21(31)35-6)28(5)18-7-9-27(4)19(17(18)13-29(25,34)24(28)33)11-22(32)38-23(27)16-8-10-36-14-16/h8,10-11,14,20,23,25,34H,7,9,12-13H2,1-6H3 |
| InChIKey | NYVMDXPRKJHQJG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|