C17H21N5O2 — CID 783993
1,3-dimethyl-8-(methylamino)-7-(3-phenylpropyl)purine-2,6-dione (PubChem CID 783993) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1,3-dimethyl-8-(methylamino)-7-(3-phenylpropyl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(methylamino)-7-(3-phenylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 783993 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1,3-dimethyl-8-(methylamino)-7-(3-phenylpropyl)purine-2,6-dione |
| SMILES | CNc1nc2c(c(=O)n(C)c(=O)n2C)n1CCCc1ccccc1 |
| InChI | InChI=1S/C17H21N5O2/c1-18-16-19-14-13(15(23)21(3)17(24)20(14)2)22(16)11-7-10-12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,18,19) |
| InChIKey | FLZPDVHRJDIJOZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |