C10H19NO2 — CID 78409508
1-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-ol (PubChem CID 78409508) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-ol.
| Compound Name | 1-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-ol |
|---|---|
| PubChem CID | 78409508 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-4-ol |
| SMILES | OCC1CCC(O)N2CCCCC12 |
| InChI | InChI=1S/C10H19NO2/c12-7-8-4-5-10(13)11-6-2-1-3-9(8)11/h8-10,12-13H,1-7H2 |
| InChIKey | XJGGJDSGTDKLPJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |