C34H48O7 — CID 78410128
6'-but-2-en-2-yl-21,24-dihydroxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one (PubChem CID 78410128) has the molecular formula C34H48O7 and a molecular weight of 568.75 g/mol. Its IUPAC name is 6'-but-2-en-2-yl-21,24-dihydroxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one.
| Compound Name | 6'-but-2-en-2-yl-21,24-dihydroxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
|---|---|
| PubChem CID | 78410128 |
| Molecular Formula | C34H48O7 |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | 6'-but-2-en-2-yl-21,24-dihydroxy-5',11,13,22-tetramethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
| SMILES | CC=C(C)C1OC2(CCC1C)CC1CC(CC=C(C)CC(C)C=CC=C3COC4C(O)C(C)=CC(C(=O)O1)C34O)O2 |
| InChI | InChI=1S/C34H48O7/c1-7-22(4)30-23(5)13-14-33(41-30)18-27-17-26(40-33)12-11-21(3)15-20(2)9-8-10-25-19-38-31-29(35)24(6)16-28(32(36)39-27)34(25,31)37/h7-11,16,20,23,26-31,35,37H,12-15,17-19H2,1-6H3 |
| InChIKey | UOKFUNLRMUEGHY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|