C9H15NO — CID 78410869
1-(2-aminopropyl)cyclohexa-2,4-dien-1-ol (PubChem CID 78410869) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-(2-aminopropyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1-(2-aminopropyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 78410869 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-(2-aminopropyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(N)CC1(O)C=CC=CC1 |
| InChI | InChI=1S/C9H15NO/c1-8(10)7-9(11)5-3-2-4-6-9/h2-5,8,11H,6-7,10H2,1H3 |
| InChIKey | GEXXKSRVDUNDLK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |