C21H22O5 — CID 78410947
3-hexanoyl-9a-methyl-6-prop-1-enylfuro[3,2-g]isochromene-2,9-dione (PubChem CID 78410947) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 3-hexanoyl-9a-methyl-6-prop-1-enylfuro[3,2-g]isochromene-2,9-dione.
| Compound Name | 3-hexanoyl-9a-methyl-6-prop-1-enylfuro[3,2-g]isochromene-2,9-dione |
|---|---|
| PubChem CID | 78410947 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-hexanoyl-9a-methyl-6-prop-1-enylfuro[3,2-g]isochromene-2,9-dione |
| SMILES | CC=CC1=CC2=CC3=C(C(=O)CCCCC)C(=O)OC3(C)C(=O)C2=CO1 |
| InChI | InChI=1S/C21H22O5/c1-4-6-7-9-17(22)18-16-11-13-10-14(8-5-2)25-12-15(13)19(23)21(16,3)26-20(18)24/h5,8,10-12H,4,6-7,9H2,1-3H3 |
| InChIKey | SULYDLFVUNXAMP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|