C31H27IN2OS2 — CID 78411015
3-ethyl-2-[[4-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]chromen-2-yl]methylidene]-1,3-benzothiazole iodide (PubChem CID 78411015) has the molecular formula C31H27IN2OS2 and a molecular weight of 634.61 g/mol. Its IUPAC name is 3-ethyl-2-[[4-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]chromen-2-yl]methylidene]-1,3-benzothiazole iodide.
| Compound Name | 3-ethyl-2-[[4-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]chromen-2-yl]methylidene]-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 78411015 |
| Molecular Formula | C31H27IN2OS2 |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 634.06 |
| IUPAC Name | 3-ethyl-2-[[4-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]chromen-2-yl]methylidene]-1,3-benzothiazole iodide |
| SMILES | CCN1C(=CC2=CC(=CC=Cc3sc4ccccc4[n+]3CC)c3ccccc3O2)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C31H27N2OS2.HI/c1-3-32-25-14-6-9-17-28(25)35-30(32)19-11-12-22-20-23(34-27-16-8-5-13-24(22)27)21-31-33(4-2)26-15-7-10-18-29(26)36-31;/h5-21H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BZQQTOFURIQLHB-UHFFFAOYSA-M |
| XLogP | 5.06 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|