C23H22N4O3S — CID 78425828
4-(4-phenoxyphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)-1,3-thiazole-5-carboxamide (PubChem CID 78425828) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-(4-phenoxyphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-(4-phenoxyphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 78425828 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 4-(4-phenoxyphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(=O)N1CCN(c2nc(-c3ccc(Oc4ccccc4)cc3)c(C(N)=O)s2)CC1 |
| InChI | InChI=1S/C23H22N4O3S/c1-2-19(28)26-12-14-27(15-13-26)23-25-20(21(31-23)22(24)29)16-8-10-18(11-9-16)30-17-6-4-3-5-7-17/h2-11H,1,12-15H2,(H2,24,29) |
| InChIKey | BKVQORVRXWTYJR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|