C23H25NO4 — CID 7844256
[(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 7844256) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7844256 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1ccccc1/C=C(/C(=O)O[C@H](C)C(=O)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H25NO4/c1-17(22(25)24-14-8-9-15-24)28-23(26)20(18-10-4-3-5-11-18)16-19-12-6-7-13-21(19)27-2/h3-7,10-13,16-17H,8-9,14-15H2,1-2H3/b20-16+/t17-/m1/s1 |
| InChIKey | ZLXZNGSFRBYVKJ-PBEQFFAXSA-N |
| XLogP | 3.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|