C19H24ClN3O4 — CID 78444062
5-chloro-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]-2-nitrobenzamide (PubChem CID 78444062) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is 5-chloro-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 78444062 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 5-chloro-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]-2-nitrobenzamide |
| SMILES | CC1CCC2CC(CCNC(=O)c3cc(Cl)ccc3[N+](=O)[O-])C(=O)NC2C1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-11-2-3-12-9-13(18(24)22-16(12)8-11)6-7-21-19(25)15-10-14(20)4-5-17(15)23(26)27/h4-5,10-13,16H,2-3,6-9H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | GSQAOEFIIFNCOU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|