C23H34N2O2 — CID 78342584
4-tert-butyl-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]benzamide (PubChem CID 78342584) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 78342584 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 4-tert-butyl-N-[2-(7-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)ethyl]benzamide |
| SMILES | CC1CCC2CC(CCNC(=O)c3ccc(C(C)(C)C)cc3)C(=O)NC2C1 |
| InChI | InChI=1S/C23H34N2O2/c1-15-5-6-17-14-18(22(27)25-20(17)13-15)11-12-24-21(26)16-7-9-19(10-8-16)23(2,3)4/h7-10,15,17-18,20H,5-6,11-14H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | ZSCXNFBCTSPWCG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |