C16H23N5O4S — CID 78453327
N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]benzamide (PubChem CID 78453327) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]benzamide.
| Compound Name | N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]benzamide |
|---|---|
| PubChem CID | 78453327 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]benzamide |
| SMILES | COCCNC(=O)CSC1NC(=O)C(NC(=O)c2ccccc2)C(N)N1 |
| InChI | InChI=1S/C16H23N5O4S/c1-25-8-7-18-11(22)9-26-16-20-13(17)12(15(24)21-16)19-14(23)10-5-3-2-4-6-10/h2-6,12-13,16,20H,7-9,17H2,1H3,(H,18,22)(H,19,23)(H,21,24) |
| InChIKey | GEPAONAFLVSZKN-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|