C15H13N2O5- — CID 78468948
4-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate (PubChem CID 78468948) has the molecular formula C15H13N2O5- and a molecular weight of 301.28 g/mol. Its IUPAC name is 4-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate.
| Compound Name | 4-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 78468948 |
| Molecular Formula | C15H13N2O5- |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoate |
| SMILES | O=C([O-])CCC(=O)N1N=C(c2ccco2)CC1c1ccco1 |
| InChI | InChI=1S/C15H14N2O5/c18-14(5-6-15(19)20)17-11(13-4-2-8-22-13)9-10(16-17)12-3-1-7-21-12/h1-4,7-8,11H,5-6,9H2,(H,19,20)/p-1 |
| InChIKey | VOSUHBRSMNYVQT-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 99.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |