C21H14N4O7 — CID 46805546
2-[2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione (PubChem CID 46805546) has the molecular formula C21H14N4O7 and a molecular weight of 434.36 g/mol. Its IUPAC name is 2-[2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 46805546 |
| Molecular Formula | C21H14N4O7 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CC(=O)N1N=C(c2ccco2)CC1c1ccco1 |
| InChI | InChI=1S/C21H14N4O7/c26-19(11-23-20(27)13-6-5-12(25(29)30)9-14(13)21(23)28)24-16(18-4-2-8-32-18)10-15(22-24)17-3-1-7-31-17/h1-9,16H,10-11H2 |
| InChIKey | FQPIRWXZYYHJMM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 139.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|