C20H18N4O5 — CID 51183167
1-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(2-methyl-3-nitroanilino)ethanone (PubChem CID 51183167) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is 1-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(2-methyl-3-nitroanilino)ethanone.
| Compound Name | 1-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(2-methyl-3-nitroanilino)ethanone |
|---|---|
| PubChem CID | 51183167 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(2-methyl-3-nitroanilino)ethanone |
| SMILES | Cc1c(NCC(=O)N2N=C(c3ccco3)CC2c2ccco2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N4O5/c1-13-14(5-2-6-16(13)24(26)27)21-12-20(25)23-17(19-8-4-10-29-19)11-15(22-23)18-7-3-9-28-18/h2-10,17,21H,11-12H2,1H3 |
| InChIKey | BBIYABAPSAEHNA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|