C20H15N3O7 — CID 55357997
[2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-nitrobenzoate (PubChem CID 55357997) has the molecular formula C20H15N3O7 and a molecular weight of 409.35 g/mol. Its IUPAC name is [2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 55357997 |
| Molecular Formula | C20H15N3O7 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-nitrobenzoate |
| SMILES | O=C(OCC(=O)N1N=C(c2ccco2)CC1c1ccco1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15N3O7/c24-19(12-30-20(25)13-5-1-2-6-15(13)23(26)27)22-16(18-8-4-10-29-18)11-14(21-22)17-7-3-9-28-17/h1-10,16H,11-12H2 |
| InChIKey | ODVCJSGANWMLBZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 128.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|