C22H17ClN4O6 — CID 40809738
[2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 40809738) has the molecular formula C22H17ClN4O6 and a molecular weight of 468.85 g/mol. Its IUPAC name is [2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 40809738 |
| Molecular Formula | C22H17ClN4O6 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | [2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)N2N=C(c3ccc(Cl)cc3)C[C@H]2c2ccco2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17ClN4O6/c23-15-6-3-13(4-7-15)17-11-19(20-2-1-9-32-20)26(25-17)21(28)12-33-22(29)14-5-8-16(24)18(10-14)27(30)31/h1-10,19H,11-12,24H2/t19-/m0/s1 |
| InChIKey | FJRNQSBSQOGYQE-IBGZPJMESA-N |
| XLogP | 3.96 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|